summaryrefslogtreecommitdiffstats
path: root/util
Commit message (Expand)AuthorAgeFilesLines
* Many changes in structure.scw2004-05-181-8/+7
* merge from trunk.scw2004-05-167-210/+29
* missing commitscw2004-05-161-0/+1
* missing commit of r1935scw2004-05-101-0/+1
* Move PERM_NOOUTMAIL from userec_t.userlevel to userec_t.uflag2scw2004-05-072-1/+37
* use atoi instead strcmpin22004-04-221-2/+2
* fix compile error & warning freein22004-04-152-3/+4
* Fix Makefile problem on installing.scw2004-04-111-1/+1
* merge dirptt2004-04-082-9/+4
* tool to merge .dir for boardsptt2004-04-081-10/+11
* merge dir toolsptt2004-04-082-1/+51
* add limit ptt2004-04-081-1/+1
* open output file instead of pipe.scw2004-04-081-1/+1
* passwd change backptt2004-04-071-2/+1
* tools for fix money bugptt2004-04-071-3/+16
* checkmoney toolsptt2004-04-061-0/+27
* check money to fix moneybugptt2004-04-061-1/+1
* sleep 2 secs between each mail if mail to .bbs (or breaks bbsmail)in22004-04-061-0/+1
* add FILE_BOTTOM for push_bottomptt2004-04-061-1/+2
* bug fixed ptt2004-03-311-19/+1
* uhashloader debugptt2004-03-311-3/+2
* debug cuserptt2004-03-313-33/+33
* uhash_loader debugptt2004-03-311-0/+3
* git-svn-id: http://opensvn.csie.org/pttbbs/trunk/pttbbs@1634 63ad8ddf-47c3-03...ptt2004-03-301-1/+1
* change function of passwdptt2004-03-301-0/+1
* git-svn-id: http://opensvn.csie.org/pttbbs/trunk/pttbbs@1632 63ad8ddf-47c3-03...ptt2004-03-301-6/+5
* before rebootptt2004-03-301-1/+18
* faster passwd by lower the lseek.ptt2004-03-301-1/+1
* git-svn-id: http://opensvn.csie.org/pttbbs/trunk/pttbbs@1623 63ad8ddf-47c3-03...ptt2004-03-291-1/+1
* support X* for cleaning boards which brdnames start with 'X'in22004-03-261-17/+28
* fix dark hole toolsptt2004-03-232-2/+75
* Remove unused strcpy().scw2004-03-121-3/+2
* HOTBOARDCACHEin22004-03-101-3/+31
* add chkhbfin22004-03-022-1/+162
* use BBSBASE for var.hin22004-02-241-4/+9
* compatible to gcc 2.95in22004-02-241-1/+3
* add boardlist.allin22004-02-201-0/+25
* use DB_Filein22004-02-181-30/+53
* fix conflict MAX_LINEin22004-02-142-6/+6
* bbsmail: reindent, ignore multipart mails, apply iconv to mail subject.in22004-02-142-53/+46
* remove dir, no output for single filein22004-02-141-3/+10
* add cleandir.plin22004-02-141-0/+47
* Change default permission of PttDigest.scw2004-02-121-1/+1
* Define string macro GLOBAL_DIGEST in pttbbs.conf to set the digest board name.scw2004-02-121-1/+10
* weather predict tomorrowvictor2004-02-122-18/+20
* fix bug in revision 1507victor2004-02-091-1/+1
* for virus mailin22004-02-081-31/+19
* 1. delete invited user from invite list when exits.victor2004-02-041-1/+5
* add some comments for ofo water mode.in22004-01-161-6/+6
* dont remove a non-exist board when logoutvictor2004-01-031-2/+0
* Remove altering wbtime in nkwbd, avoiding race.scw2004-01-031-1/+0
* same as revision 1452victor2004-01-031-0/+2
* set default to 20, 20,in22004-01-031-9/+6
* Adding setproctitle for NoKillWaterBalld in shmctl.scw2004-01-021-0/+2
* warning freein22004-01-011-58/+58
* NOKILLWATERBALL done.in22004-01-011-0/+67
* re-indent, getopt(), -h for help, and more flexible.in22003-12-151-66/+107
* fix output alignment when #devices >= 10in22003-12-051-1/+1
* fix assess, it may be rewritenvictor2003-12-011-2/+0
* merge back from fav4 brachesvictor2003-11-221-13/+1
* 1. fix invalid operationvictor2003-11-141-0/+4
* fix from addressin22003-11-131-1/+4
* typovictor2003-11-041-1/+1
* allow bm to decide whether to up-ten-bigvictor2003-11-042-2/+11
* use MYHOSTNAMEin22003-11-041-1/+1
* remove debug messagein22003-11-041-1/+0
* use bbs.h, add Message-IDin22003-11-041-18/+10
* complete assessvictor2003-10-271-7/+29
* usermodein22003-10-231-0/+14
* merge hotboard into shmctlin22003-10-233-75/+65
* ignore BRD_GROUPBOARDin22003-10-211-0/+1
* use isvisiableboard()in22003-10-211-2/+9
* add hotboardin22003-10-212-1/+67
* fix makefilevictor2003-10-141-1/+1
* wrong filenamevictor2003-10-142-2/+2
* fix cleanshm, add to Makefile (but not in default entry)victor2003-10-142-1/+4
* 1. add feature assessment of article and salevictor2003-10-141-0/+25
* add mail headervictor2003-10-081-2/+2
* reduce sort times in utmpsortdin22003-09-261-27/+44
* use 'mkdir -p'in22003-09-131-1/+2
* attach SHMvictor2003-09-021-0/+2
* for vary OSvictor2003-08-201-0/+3
* fix util merging errorvictor2003-08-182-2/+4
* uselessvictor2003-08-151-31/+0
* merge util_passwd.c to mbbsd/passwd.cvictor2003-08-151-142/+0
* merge util_record.c to mbbsd/record.cvictor2003-08-151-5/+4
* merge util_record.c to mbbsd/record.cvictor2003-08-1536-293/+47
* clean the sourcevictor2003-08-152-90/+17
* use NULL instead of (~ 0) in class linked-listin22003-08-123-11/+8
* replace FreeBSD macro with __FreeBSD__kcwu2003-08-101-3/+3
* ignore hidden boardsvictor2003-08-091-2/+2
* new match patter for rev 1081in22003-08-061-1/+1
* use svn:ignorein22003-08-041-47/+0
* add BMin22003-07-211-2/+12
* fix error make rule for bbsmailin22003-07-211-3/+3
* add attach_SHM()in22003-07-211-6/+6
* merge from MergeCachein22003-07-2026-676/+169
* add bbsmail to CPROG_WITHOUT_UTILin22003-07-191-2/+2
* add LDFLAG in bbsmailin22003-07-171-2/+2
* for porting to linuxvictor2003-07-141-6/+8
* remove require and add commentsin22003-07-111-2/+2
* remove unused varsin22003-07-111-2/+1
* add boardlistin22003-07-111-2/+3
* *** empty log message ***in22003-07-112-0/+107
* ignore  in22003-07-111-0/+1
* better formattingin22003-07-111-8/+6
* count #Welcomes in account to SHM instead of mbbsd.cin22003-07-051-1/+9
* s/�\/�\\//in22003-07-051-1/+1
* use open/read instead catin22003-07-041-1/+4
* add listbrdin22003-07-041-2/+30
* move BBSFileHeader.pm to util/in22003-07-031-0/+58
* *** empty log message ***ptt2003-07-021-3/+3
* *** empty log message ***ptt2003-07-021-1/+1
* *** empty log message ***ptt2003-07-021-28/+33
* *** empty log message ***ptt2003-07-021-6/+6
* *** empty log message ***ptt2003-07-021-7/+8
* root overwritein22003-06-291-1/+5
* *** empty log message ***in22003-06-251-0/+8
* change [] to *in22003-06-221-2/+2
* move COMPILE_TIME from .mk to vers.cin22003-06-221-0/+8
* typeoin22003-06-211-4/+4
* add $Id$in22003-06-211-0/+1
* add dir 'run'in22003-05-231-2/+12
* outta timer:pvictor2003-05-171-2/+14
* *** empty log message ***ptt2003-05-172-9/+54
* add commentsin22003-05-151-1/+4
* warning freein22003-05-154-6/+9
* fix xchatd rulein22003-05-151-3/+3
* remove smtestin22003-05-155-886/+0
* use pttbbs.mkin22003-05-151-159/+41
* timedin22003-05-151-4/+20
* OUTTA_TIMERbbs2003-05-071-1/+4
* change sourcevictor2003-05-071-7/+2
* add flag qacfin22003-04-251-20/+48
* fix > 100% busy, sorted outputin22003-04-241-10/+35
* re-initiate counterin22003-04-221-0/+1
* add mail header: Mime-Version, Content-Type, Content-Transfer-Encodingin22003-04-201-3/+11
* remove bad dirin22003-04-141-0/+0
* sleep interval in argv[1]in22003-04-111-2/+7
* handle bad input to avoid SIGSEGVin22003-04-101-2/+6
* when GV2.e.noonlineuser, do NOT search if the author is online in article listin22003-04-081-2/+3
* *** empty log message ***in22003-04-081-1/+1
* dymaxactive, toomanyusersin22003-04-071-2/+2
* support GV2in22003-04-071-10/+26
* use make.conf's CFLAGin22003-04-051-23/+24
* change linkvictor2003-04-021-4/+4
* change urlin22003-04-021-2/+2
* mv LocalVars.pm.sample sample/LocalVars.pmin22003-04-011-24/+0
* printresult() after normal terminatedin22003-03-301-0/+1
* ���T���p���@��in22003-03-301-9/+26
* add installdiskstatin22003-03-291-1/+6
* reprint header when SIGINT. discard first datain22003-03-291-2/+4
* *** empty log message ***in22003-03-291-0/+1
* diskstatin22003-03-292-74/+690
* add diskstat.cin22003-03-281-0/+99
* commentsin22003-03-282-3/+10
* remove cmsignalin22003-03-221-4/+1
* remove cmsignal()in22003-03-221-17/+1
* *** empty log message ***in22003-03-221-1/+2
* use another source insteadbbs2003-03-011-2/+8
* s/��/�O/ by rafanin22003-02-201-3/+3
* add charset, encoding, and ctype by rafanin22003-02-191-4/+7
* -O3 => -Oin22003-02-181-3/+3
* shmctl doesn't need resolve_boards() firstin22003-02-181-2/+3
* exit if bcache if not loadedin22003-02-161-2/+3
* trainvictor2003-02-112-2/+121
* lazy sort utmpin22003-02-111-2/+13
* fix bug in resolve_board()in22003-02-111-1/+4
* ���������g����lynx���|victor2003-02-071-2/+6
* utmpsortdin22003-01-251-98/+139
* critical memory cleanin22003-01-191-1/+20
* skip null datain22003-01-191-0/+1
* garbagekcwu2003-01-161-0/+0
* s/����\&\#22531\;/���}/g;in22002-11-201-3/+11
* some comment in mail bodyin22002-11-171-3/+11
* move error board to boards.error/in22002-11-111-2/+6
* Linux compatiblein22002-11-091-0/+5
* remove mdclean, splitpasswdin22002-11-094-140/+2
* fix bugin22002-11-061-2/+2
* fix bug of utmpfix fast modein22002-11-051-18/+17
* rebuildalohain22002-11-042-2/+2
* (utmpfix)timeout by idle timein22002-11-031-35/+57
* (utmpfix)clean lowerboundin22002-11-031-4/+11
* fix bugin22002-11-021-2/+4
* warning freein22002-11-0214-19/+30
* strip_ansi titlein22002-11-021-10/+43
* newin22002-10-271-1/+32
* fix host bugin22002-10-051-3/+3
* *** empty log message ***in22002-09-301-3/+3
* mvdirin22002-09-271-0/+35
* $content =~ s/��/��/g;in22002-09-251-0/+1
* fix bugin22002-09-211-1/+1
* fix bugin22002-09-201-1/+2
* *** empty log message ***in22002-09-201-0/+10
* url changein22002-09-201-3/+3
* s/��/�Q/g;in22002-09-061-0/+1
* interval every 3mins -> 1minin22002-09-031-2/+2
* fix bug of year display shift by 1kcwu2002-08-301-2/+2
* remove filtermail.plin22002-08-201-3/+3
* remove OUTTA_CACHEin22002-08-204-269/+2
* cacheserver.cin22002-08-191-27/+46
* outta cachein22002-08-174-2/+250
* *** empty log message ***in22002-08-171-8/+10
* use lib '/home/bbs/bin/'in22002-08-161-0/+1
* add $LYNX $GREPin22002-08-151-3/+4
* udnnews.plin22002-08-152-2/+102
* remove cleancache.plin22002-08-152-28/+2
* don't show the listing if it's hiddenkcwu2002-08-121-2/+4
* set OSTYPE by `uname'kcwu2002-08-121-2/+2
* clean fav, zapin22002-08-071-0/+2
* add cleancache.plin22002-08-071-0/+24
* add indexuserin22002-08-071-1/+1
* listpidin22002-08-071-1/+11
* $MYHOSTNAMEin22002-08-071-0/+1
* *** empty log message ***in22002-08-071-2/+2
* fix lynx big5 encoding problemkcwu2002-07-231-2/+3
* fix utmpfix bugin22002-07-231-9/+9
* error returnin22002-07-201-3/+8
* *** empty log message ***ptt2002-07-181-3/+3
* *** empty log message ***ptt2002-07-181-3/+6
* *** empty log message ***ptt2002-07-181-6/+15
* *** empty log message ***ptt2002-07-182-2/+46
* remove mind fixin22002-07-051-6/+1
* weather url changedin22002-07-041-2/+2
* chdir(BBSHOME)in22002-07-011-1/+2
* avoid utmp->friendtotal errorin22002-07-011-1/+3
* board cache problemin22002-07-011-6/+5
* fix �Q�j/���Q�jin22002-07-011-1/+2
* last oneptt2002-06-301-2/+2
* *** empty log message ***ptt2002-06-301-4/+4
* *** empty log message ***ptt2002-06-301-6/+6
* *** empty log message ***ptt2002-06-301-2/+2
* fix bugptt2002-06-301-4/+4
* *** empty log message ***ptt2002-06-301-2/+1
* *** empty log message ***ptt2002-06-301-22/+18
* testbugptt2002-06-301-17/+20
* bid errprptt2002-06-292-5/+5
* againptt2002-06-291-2/+2
* important errorptt2002-06-291-2/+2
* try toplazyBMptt2002-06-292-5/+8
* fix bug(last commit)in22002-06-281-2/+1
* two mail relay serversin22002-06-281-16/+76
* ignore executable 'splitpasswd'kcwu2002-06-271-0/+2
* bad filekcwu2002-06-271-9/+0
* remove fixbfriendin22002-06-261-22/+4
* fix record.c stamp preformanceptt2002-06-231-2/+2
* fix old letterptt2002-06-221-1/+1
* *** empty log message ***lwms2002-06-198-37/+37
* *** empty log message ***ptt2002-06-173-3/+6
* *** empty log message ***ptt2002-06-171-3/+3