summaryrefslogtreecommitdiffstats
Commit message (Expand)AuthorAgeFilesLines
* - fix compiler warningspiaip2008-03-303-4/+5
* - fix compile errorpiaip2008-03-301-1/+1
* - fix: new_register failed to create new regformpiaip2008-03-301-9/+14
* - change 'chicken' to 'pet' in utmp description (ad24@PttSuggest)piaip2008-03-301-1/+1
* - read: add 'search for "s"' in G searchpiaip2008-03-303-7/+25
* - upgrade script: fix Makefile for compilation.piaip2008-03-291-2/+2
* - register: message fixpiaip2008-03-291-1/+4
* - register/regform2: add 'assign user' option.piaip2008-03-291-7/+29
* - (experimental) mask ip(fromhost): USE_MASKED_FROMHOSTpiaip2008-03-2912-24/+74
* - fix reaper utility to make it really works.piaip2008-03-291-9/+139
* - expiring user after board set to hidden state.piaip2008-03-292-0/+11
* - fix compile error for regform1piaip2008-03-291-0/+1
* - make regform2 complete by upgrading scripts.piaip2008-03-297-35/+228
* - change the chinese description of b_note and message finetune.piaip2008-03-282-4/+4
* - bnote: change board_note display settings to make it more meaningful.piaip2008-03-282-13/+39
* - register: (exp) complete testing code for regform 2: now enables testing fr...piaip2008-03-284-138/+234
* - (internal) move UTIL_C API from mbbsd/stuff to cmbbs.piaip2008-03-2713-132/+197
* - code clean upkcwu2008-03-275-30/+33
* - fix syntax for old c compiler.kcwu2008-03-273-8/+13
* (internal) drop src directory (moved to common/ now)piaip2008-03-2716-2510/+0
* (internal) refine directory layout: libbbs/libbbsutil -> common/bbs,sys.piaip2008-03-2728-19/+2533
* - (internal) move osdep to libbbsutilpiaip2008-03-267-6/+9
* correct file character setwens2008-03-260-0/+0
* - (internal) util update - sync with latest librarypiaip2008-03-266-232/+24
* - (internal) moving more bbs-independent code to utility library.piaip2008-03-2612-216/+221
* - (internal) directory layout structure finetunepiaip2008-03-2625-2/+10
* - board_config: many people get confused about "one month", let's display "30...piaip2008-03-261-3/+7
* - (internal) drop deprecated old OS support. focus on modern Linux/FreeBSD now.piaip2008-03-268-624/+258
* - refine board_config display (prevent garbage restriction display)piaip2008-03-251-4/+19
* - change kill_user log from VIOLATION to SECURITY.piaip2008-03-251-1/+5
* - prevent buffer overflow issues.piaip2008-03-241-18/+17
* - log reason for adm killing user accountspiaip2008-03-241-0/+5
* - fix buffer overflow (due to some invalid friend file containing very long id)piaip2008-03-241-3/+5
* - fix user over18 display in admin's user_display.piaip2008-03-243-17/+24
* - revise code slightly.piaip.newlayout@4011kcwu2008-03-201-51/+67
* - (setup) update sample config filespiaip2008-03-192-25/+16
* - cancelbadpost: prevent update request masked by potential new badposts.piaip2008-03-191-3/+6
* - Fix compilation error: Rename is now in libbbsutil.piaip2008-03-182-0/+5
* - check_and_expire: allow preserving accounts for one year (if not requested ...piaip2008-03-181-12/+12
* - register: account expiring: fix offset-by-one issue.piaip2008-03-181-1/+2
* - prevent minus Z search messages shown on OLDRECOMMEND systemspiaip2008-03-181-1/+5
* - register: allow expiring accounts created more than one year before.piaip2008-03-182-10/+24
* - read: search_recommend: add searching recommend<0, for helping BM managementpiaip2008-03-171-3/+6
* - prompt fine-tune: change 'uppercase I' to i.piaip2008-03-163-8/+8
* - Happy r4000!piaip2008-03-153-5153/+5153
* - fix crash for mail->'c'->man->D.piaip2008-03-152-2/+5
* - bbs: prevent repeated showing board_enter_notespiaip2008-03-153-4/+7
* - mail: enable z for some users who already have mail-man before.piaip2008-03-121-2/+5
* - change show_file parameter to assign striping options in a better way.piaip2008-03-127-22/+52
* - fixed: 'y' for replying in boardspiaip2008-03-122-0/+5
* pmore/mail/modes: enable 'y' for multi-reply in mail reading, and fix non-upd...piaip2008-03-125-17/+44
* - vt100/200 key conversion: improve error handling (may cause endless loop) f...piaip2008-03-121-10/+22
* - fix crash: should check every return value of strtok_r.piaip2008-03-111-5/+3
* - eliminate compile warningspiaip2008-03-113-3/+3
* - removed indict, because there's no any reason to keep those out-dated data.piaip2008-03-115-243/+9
* - revert testing code: should not check-in.piaip2008-03-111-6/+0
* - chicken: fix sudden-death after reviving 'too tired' or 'too full'.piaip2008-03-112-1/+9
* - chicken: revive should update lastvisit to prevent die again.piaip2008-03-111-4/+7
* - chicken: prevent confusing displaypiaip2008-03-111-3/+7
* - user: display over18 evalulation resultpiaip2008-03-112-4/+11
* - over18 check is redundent in complete check.piaip2008-03-101-2/+1
* - BM should have permission, even over18. Also we prevent over18 BMs setting ...piaip2008-03-101-6/+11
* - fix bug: board active user limit (may exceed 32768)piaip2008-03-101-1/+2
* - mail: fix non-exist file crashpiaip2008-03-102-4/+376
* - talk: reduce GotoNewHand crash (C-Uhh or C-Urhh)piaip2008-03-091-9/+18
* - board: 's' - remove the global search after empty input (because we cannot ...piaip2008-03-081-2/+11
* - mail: fix forward error for 'x' addresspiaip2008-03-081-2/+2
* - menu: message improvement.piaip2008-03-081-1/+1
* - mail: never use 'x' as foward address. help manual registered users.piaip2008-03-081-1/+2
* - register: Regform2 API prototype (for concurrent registration form validati...piaip2008-03-087-24/+523
* - chicken/upgrade: add live upgrade functionpiaip2008-03-074-27/+116
* - upgrade script updatepiaip2008-03-063-4/+6
* - register: general code refine, no functionality change.piaip2008-03-061-320/+317
* - more: change 's' to 'select-board' instead of 'search'.piaip2008-03-065-24/+41
* - user/chicken: enable sysop toggle chicken-deathpiaip2008-03-065-16/+51
* - chicken: enable PK with new mmap stylepiaip2008-03-063-3/+6
* - chicken: move chicken data to user directory, with mmap based synchronization.piaip2008-03-065-136/+303
* - upgrade: directory for all upgrading scripts/tools/programspiaip2008-03-064-0/+239
* - [code refine] move all registration code to register.cpiaip2008-03-064-1836/+1814
* - pmore/common: prompt message finetune for recommendationpiaip2008-03-053-8/+11
* - talk: warn user that we don'e accept empty input for talklog decision.piaip2008-03-051-2/+10
* - msg update: prevent using "illegal/invalid" confusing terms, and other mino...piaip2008-03-043-8/+11
* - add option "default to backup" (from PttSuggest@ptt2)piaip2008-03-035-9/+31
* - prevent resending regforms if regcode is incorrect.piaip2008-03-031-2/+7
* - pmore/movie: rollback *[m prefix - not really so common.piaip2008-03-022-8/+6
* - pmore/movie: more comments on LS usage.piaip2008-03-021-0/+15
* - display remaining days info for chatroom restriction piaip2008-03-021-2/+3
* - enable ESC[m as prefix for pmore movie (for some ANSI editors)piaip2008-03-024-7/+33
* - add warning on famous gamespiaip2008-03-011-1/+10
* - improve violation-pay process (prevent misunderstanding)piaip2008-03-011-16/+28
* - mail: fail-safe filename check to avoid segv crashpiaip2008-02-291-0/+6
* - message improve: mark for recommend restrictionpiaip2008-02-291-1/+1
* - give_money: reduce the chance to require password authenticationpiaip2008-02-261-4/+19
* - unify give_money in both userlist/g and menu/g.piaip2008-02-263-27/+15
* - give_money: require user input password again, to prevent malicious macrospiaip2008-02-261-5/+41
* - b_config: prompt fine-tune, reducing unnecessary messagespiaip2008-02-261-28/+42
* - b_config: more detail hints on user post permission checkingpiaip2008-02-264-34/+52
* - admin: reject reason finetune, suggested by iamori@pttpiaip2008-02-251-2/+2
* - admin: should not allow changing info when browsing PASSWD history.piaip2008-02-241-1/+3
* - admin: fixed: searching user generates wrong unumpiaip2008-02-242-7/+18
* - asses: gpfix: align MAXGP to real value.piaip2008-02-241-5/+7
* - admin: improve regform UI by various feedbackspiaip2008-02-241-5/+33
* - assess: when fixing goodpost number, overwrite values even if alerted.piaip2008-02-231-1/+5
* - mbbsd: correct default value promptspiaip2008-02-232-48/+70
* - bbs: deleting and creating posts now will change numpost only if file has v...piaip2008-02-221-27/+49
* - more: should not able to change title in sysopedit. (rpt by daiYuTsung@PttB...piaip2008-02-221-1/+4
* - admin: improve new regform ui <real test version>piaip2008-02-211-12/+43
* - admin: fine-tune and improve admin regform new UIpiaip2008-02-211-4/+33
* - admin: new-regform: fixed: 'q' deletes all forms in last page.piaip2008-02-211-5/+12
* - mbbsd: improve promptspiaip2008-02-212-19/+78
* - board: comment on symlinkpiaip2008-02-212-300/+290
* - talk: comment on mail_checkpiaip2008-02-213-4/+12
* - admin: change 'X' to 'D' for invalid accountspiaip2008-02-213-2/+12
* - admin: (exp) new admin interface for regform validation (page mode)piaip2008-02-202-26/+533
* - prepare for new admin reg procedurepiaip2008-02-203-5/+31
* - cache: aggresive song detection: provide more debug messagespiaip2008-02-191-6/+15
* user: improve regcode prompt/checkpiaip2008-02-192-27/+118
* - improve order song agreementpiaip2008-02-191-8/+11
* - improve the message and explain for fix_aloha.piaip2008-02-191-5/+7
* - notify user if the regcode is already expired.piaip2008-02-191-3/+8
* - mail: do not add numposts for cross-posting mailspiaip2008-02-172-16/+13
* - change BIG5 ':' to SBCS, more convenient for admins to copy/paste data. (su...piaip2008-02-151-7/+7
* - hide restricted board names when cross-posting (suggested by iamori@ptt1)piaip2008-02-151-2/+13
* - testing to narrow down buffer overrun reasonpiaip2008-02-151-3/+11
* - verify if record entry is still valid before modifying.piaip2008-02-151-0/+10
* - user: make message more clear (reported by Kinra@PttSuggest)piaip2008-02-151-2/+5
* - xchatd: allow ignoring users not in chatroom.piaip2008-02-152-16/+66
* - more options to prevent chatroom floodingpiaip2008-02-141-5/+65
* - drop all 033 dirty ANSI characterpiaip2008-02-141-1/+1
* - lovepaper: add newmail alert, fix title issue. (reported by watch@pttbug)piaip2008-02-141-1/+8
* - improved user searchingpiaip2008-02-141-21/+51
* - searching user should bypass invalid recordspiaip2008-02-141-0/+5
* - SRexpire: enable expiring search cache recordspiaip2008-02-135-8/+66
* - friend: use constants, prevent magic numberspiaip2008-02-132-2/+3
* - the report for changing user permission should use post_msg, to prevent wro...piaip2008-02-131-29/+21
* - user: fix the prompt of illegal regcode.piaip2008-02-101-4/+5
* - bbs: fix delay of deleted/junk directory. (reporeted by watch@ptt2.PttBug)piaip2008-02-101-1/+1
* - add dashc() for file create timepiaip2008-02-105-21/+27
* - menu: pad title length to align most fields againpiaip2008-02-092-3/+3
* - bbs: isolate edflags determinationpiaip2008-02-081-14/+20
* - reply: boards with NOREPLY should enable mail reply by default.piaip2008-02-081-2/+5
* - reduce the chance of alert messagespiaip2008-02-052-6/+12
* - add warning messages to alert about cross-postpiaip2008-02-052-3/+10
* - board: add more colors to hot-boardspiaip2008-02-041-1/+11
* - emaildb: use fork to reduce memory wastingpiaip2008-02-042-11/+66
* - dice: no longer supportedpiaip2008-02-043-473/+6
* - user: prevent printing zeros if mobile has not been setpiaip2008-02-012-1/+41
* - Makefile update: to add more conditional flags and ctags builderpiaip2008-01-311-1/+15
* - __libc_freeres() seems releasing "all" runtime memory, which may cause SEGV...piaip2008-01-311-1/+2
* - more checks on fhdr to prevent crashpiaip2008-01-311-2/+7
* - emaildb: apply cache reductionpiaip2008-01-311-0/+8
* - change over18 calculation as standalone function, in order user changed bir...piaip2008-01-315-16/+36
* - read: fix bottom articles across pages (after doing new post) will lead to ...piaip2008-01-311-4/+9
* - fav: add TEST to default fav boards and change orderpiaip2008-01-311-3/+10
* - register: make birthday registration earlier, also helps over18 work correc...piaip2008-01-314-4/+36
* - mbbsd: consider "no birthday" as less than 18 years oldpiaip2008-01-302-2/+8
* - fix over18 calculationpiaip2008-01-301-4/+10
* - improve registration processpiaip2008-01-305-78/+122
* -- emaildb: release runtime cache resource to reduce memory after emaildb bei...piaip2008-01-301-0/+4
* - improve registration process: modify justify earlier, and fix emaildb limit...piaip2008-01-302-32/+45
* - remove strncpy(). use memcpy() and strlcpy() instead.piaip2008-01-306-12/+9
* - board: enable changing to MyFavorite in HotBoardspiaip2008-01-304-9/+3
* - read: make cursor default position before .DIR.bottom articlespiaip2008-01-292-4/+7
* - bbs: change default cursor location to "end of .DIR records" excluding .DIR...piaip2008-01-292-4/+3
* - mail: enlarge check range again, due to some people lost newmail notificati...piaip2008-01-281-1/+1
* - pmore: optimization on movie/frame movepiaip2008-01-281-50/+50
* - read: avoid black holes, even if board article counter is wrong.piaip2008-01-281-17/+42
* - xchatd: prevent malicious user flooding chat page to hide his useridpiaip2008-01-281-3/+3
* - user: hinting on SYSOP permission update of setting emailpiaip2008-01-285-7/+21
* mark dirty after set_attr, fix bug reported at #17dLCl9P (SYSOP) [ptt.cc]victor2008-01-281-0/+1
* - mail: fix assert in case some new mail has empty filename.piaip2008-01-281-1/+2
* - user: allow admins to change email to 'invalid'.piaip2008-01-283-5/+11
* Temporary version of aids.cmhsin2008-01-261-0/+291
* - board: revert back with traditional stylepiaip2008-01-261-3/+12
* - menu: fix compilation error (typedef/struct)piaip2008-01-261-1/+1
* - bbslua: add iolimit() apipiaip2008-01-262-6/+24
* - revise menu.c code.kcwu2008-01-264-70/+63
* - mbbsd: provide the possibility to optimize some API. keep port information.piaip2008-01-262-6/+34
* - buy-mail-box: prevent user accidentally enter the option.piaip2008-01-251-2/+41
* Fix AID search for blackholed boards.mhsin2008-01-251-2/+4
* - bbs: prevent post-reply respond to invalid userpiaip2008-01-251-12/+28
* avoid empty filenameswens2008-01-251-2/+4
* - edit: fixed currbid=0 assert for anti-crosspost check over non-posts.piaip2008-01-251-19/+28
* - revise code uinfo_query(); fix bug: user will be killed if set perm bits to 4.kcwu2008-01-241-82/+91
* - remove duplicated prototype.kcwu2008-01-241-1/+0
* - revise passwd_apply() api, prevent use global variable to pass data.kcwu2008-01-244-30/+35
* - announce: prevent asserts for "entering deleted directories".piaip2008-01-241-11/+31
* - Tagging: offset-by-one error on alerting userpiaip2008-01-232-2/+2
* - read: more check on TagNum to prevent announce paste bugpiaip2008-01-232-4/+4
* - menu: cursor_position is not really useful. and it will cause SEGV for piaip2008-01-231-7/+2
* - bbslua: prepare for storage APIpiaip2008-01-231-51/+116
* - stuff: fix show_file auto wrapped for file with length=80piaip2008-01-223-5/+8
* - emaildb(init): speed up by transactionpiaip2008-01-211-4/+22
* - emaildb: add the init functionalitypiaip2008-01-211-1/+82
* - menu: board admins should be able to do E in admin menupiaip2008-01-211-1/+1
* - Makefile: modified for static libraries and provide hints for different sys...piaip2008-01-211-4/+10
* - fix limit edit displaypiaip2008-01-211-4/+4
* - bbslua: bugfix for toc redirecting and displaypiaip2008-01-211-2/+1
* - bbslua: fix w32 snprintf issuepiaip2008-01-191-2/+2
* - bbslua: fix w32 issuepiaip2008-01-191-4/+4
* - bbslua: change userid() to variable, add usernick, restrict more on lastref.piaip2008-01-192-12/+50
* - bbslua: require LatestRef/Title match for latest referringpiaip2008-01-192-100/+394
* - improve input system logicpiaip2008-01-192-1/+17
* - fix compile error (reported on watch@PttBug/ptt2)piaip2008-01-181-0/+2
* - bbslua: fix bbs.kball() on w32 portpiaip2008-01-181-1/+9
* - var/user: prevent printing NULL for login view confpiaip2008-01-162-4/+6
* - bbs: allow local mail for web based tarqueuepiaip2008-01-166-34/+96
* - pfterm: fixed resize crash issue. GREAT THANKS TO kcwu.piaip2008-01-161-18/+31
* - edit: rich support of Lua syntax highlightpiaip2008-01-151-20/+226
* - bbslua: add default value for getdata, add LatestRefpiaip2008-01-141-23/+132
* - bbs: add title for AID displaypiaip2008-01-147-18/+102
* - edit: simple Lua syntax highlightpiaip2008-01-141-14/+123
* - enable ncurses 'typeahead' APIpiaip2008-01-134-8/+66
* - bbslua: minor revisekcwu2008-01-131-6/+7
* - fix warnings.kcwu2008-01-131-2/+2
* - fix warnings, eol-stylekcwu2008-01-131-21/+21
* - Makefile: identify objects in more detailpiaip2008-01-121-9/+12
* - bbslua: fixed bbs.clock() calculation on win32 portpiaip2008-01-121-6/+12
* - bbslua: limit lua memory usage.kcwu2008-01-121-5/+49
* - io/getdata: close buffer piaip2008-01-121-0/+1
* - chicken: stop making political petspiaip2008-01-121-2/+5
* - license text updatepiaip2008-01-123-10/+48
* - bbslua/pfterm: Add Win32 portingpiaip2008-01-122-28/+136
* - bbslua: correct line number in file.kcwu2008-01-111-3/+38
* - chicken: disable sellingpiaip2008-01-113-71/+6
* - enable t_column width of content.piaip2008-01-111-5/+12
* - bbslua: enable ^C to break <workaround>piaip2008-01-112-15/+73
* - screen: fix compilation error, reported on watch@PttBugpiaip2008-01-111-3/+3
* - xchatd: prevent ignored users flood by entering/leaving chatroomspiaip2008-01-101-2/+2
* - bbslua: add new toc display/compatibility warning and 0.113 APIpiaip2008-01-102-70/+215
* - pfterm: fix previous patchset - x forgot to increasepiaip2008-01-101-0/+1
* - pfterm: handle X position better.piaip2008-01-101-16/+11
* - terminal: add newwin()piaip2008-01-103-8/+62
* - pmore: disable massive scroll for smooth output in pftermpiaip2008-01-102-28/+12
* - mmbsd: improve DEBUGSLEEP proctitle for debugging multiple versionspiaip2008-01-103-5/+40
* - bbslua: fixed: pause() return integer (should be string)piaip2008-01-081-8/+13
* - pmore: try to prevent munmap crash issuepiaip2008-01-082-10/+29
* - bbslua: fix corrupted coroutinepiaip2008-01-081-21/+39
* - refine limit edit sourcepiaip2008-01-082-107/+118
* - since there's nothing to use for non-reg-ok users in menu 'P', disable it.piaip2008-01-071-1/+1
* - term: add doupdate() to force refresh even if input queue is not emptypiaip2008-01-075-17/+27
* - bbslua: add TOC infopiaip2008-01-071-17/+127
* - bbslua: add version infopiaip2008-01-072-34/+62
* - bbs: enhance title editingpiaip2008-01-073-9/+189
* - bbslua: enable bbs:clock()piaip2008-01-061-7/+38
* - fixed: peek_input keeps waiting for new input. (due to buf control)piaip2008-01-064-14/+21
* - bbslua: add more APIpiaip2008-01-064-6/+80
* - display userid in xchatd (to prevent spammers, reported by PttSuggest)piaip2008-01-061-2/+2
* - mail: prevent false alerts more carefullypiaip2008-01-067-35/+99
* - fix potential exploits (reported by kcwu)piaip2008-01-053-4/+23