summaryrefslogtreecommitdiffstats
Commit message (Expand)AuthorAgeFilesLines
...
* registerin22002-10-261-54/+81
* in searchuser, return 0 if uhash is wrongin22002-10-241-2/+2
* *** empty log message ***ptt2002-10-1814-0/+1610
* registerin22002-10-161-19/+33
* group writablein22002-10-061-1/+1
* first commitin22002-10-066-0/+1571
* fix host bugin22002-10-051-3/+3
* KEY_DEL, KEY_HOME, KEY_END of getdata()in22002-10-021-1/+4
* *** empty log message ***in22002-09-301-3/+3
* mvdirin22002-09-271-0/+35
* avoid reentrantin22002-09-271-1/+6
* only read favbuf & brdbuf before one need it,in22002-09-272-11/+33
* $content =~ s/��/��/g;in22002-09-251-0/+1
* fix bugin22002-09-211-1/+1
* fix bugin22002-09-201-1/+2
* *** empty log message ***in22002-09-201-0/+10
* fix bug for SYSOP change fromhostin22002-09-201-2/+2
* url changein22002-09-201-3/+3
* DEBUGSLEEPin22002-09-181-1/+3
* (userlist)long screen supportin22002-09-161-29/+33
* t_columns should not set as ANSILINELENkcwu2002-09-111-2/+2
* add TODO commentkcwu2002-09-111-1/+2
* quick hack to fix the clear_to_eol bug in board listkcwu2002-09-112-4/+5
* not only long screen, but also width screenkcwu2002-09-115-17/+33
* fix screen rotate bug when returning from Ctrl-Ukcwu2002-09-113-4/+6
* remove unused codein22002-09-071-13/+1
* == -> =lwms2002-09-071-2/+2
* g is uselesslwms2002-09-071-3/+3
* badfriendin22002-09-071-23/+29
* s/��/�Q/g;in22002-09-061-0/+1
* only read friend description when he is my friendkcwu2002-09-041-8/+12
* when return from hotkey function, restore utmpmodekcwu2002-09-041-1/+3
* revert last domenu() fix, change the permission setting insteadkcwu2002-09-042-11/+6
* interval every 3mins -> 1minin22002-09-031-2/+2
* advetise ptt2ptt2002-09-021-2/+2
* registerin22002-09-021-6/+12
* fix bug of year display shift by 1kcwu2002-08-301-2/+2
* For personal privacy, some functions should only be used on debug purpose.kcwu2002-08-292-46/+27
* fix last commit bugin22002-08-281-2/+2
* when enter menu, relocate position firstkcwu2002-08-282-3/+5
* remove sex sort functionkcwu2002-08-281-11/+1
* check permission for mailkcwu2002-08-281-5/+7
* overload messagein22002-08-281-13/+29
* registerin22002-08-281-3/+12
* recommend lockin22002-08-261-1/+3
* preserve past screen when growing screen sizekcwu2002-08-251-1/+2
* fix memory errorin22002-08-251-1/+2
* fix recommendin22002-08-251-3/+6
* edit lockin22002-08-253-4/+53
* turn on full screen support if shell login.kcwu2002-08-252-3/+5
* let scr_lns = t_lines;kcwu2002-08-251-1/+2
* chkloadin22002-08-241-13/+10
* pttbbs.conf could overwrite MAX_BOARDin22002-08-241-1/+3
* fix memory errorin22002-08-243-5/+10
* DYMAX_ACTIVEin22002-08-232-4/+13
* (3rd)smaller memory usein22002-08-212-49/+70
* (2nd) use smaller memoryin22002-08-211-27/+7
* fix last commit bugin22002-08-201-4/+5
* abort_bbs() if data of currutmp is wrongin22002-08-201-1/+7
* remove filtermail.plin22002-08-201-3/+3
* nbrd uses smaller memoryin22002-08-201-6/+27
* remove OUTTA_CACHEin22002-08-2012-534/+9
* larger cachesizein22002-08-201-1/+1
* fix last commit bugin22002-08-191-1/+9
* cache server2in22002-08-192-41/+111
* cacheserver.cin22002-08-191-27/+46
* outta cachein22002-08-177-9/+289
* *** empty log message ***in22002-08-171-8/+10
* use lib '/home/bbs/bin/'in22002-08-161-0/+1
* load cache at first timein22002-08-151-3/+7
* add $LYNX $GREPin22002-08-151-3/+4
* udnnews.plin22002-08-152-2/+102
* remove cleancache.plin22002-08-152-28/+2
* don't show the listing if it's hiddenkcwu2002-08-121-2/+4
* set OSTYPE by `uname'kcwu2002-08-121-2/+2
* fix last commit,kcwu2002-08-091-2/+2
* no need to change the case of first charkcwu2002-08-091-2/+2
* reentrantin22002-08-071-2/+5
* clean fav, zapin22002-08-071-0/+2
* favbuf, zapbuf swapoutin22002-08-072-2/+39
* add cleancache.plin22002-08-071-0/+24
* add indexuserin22002-08-071-1/+1
* listpidin22002-08-071-1/+11
* $MYHOSTNAMEin22002-08-071-0/+1
* *** empty log message ***in22002-08-071-2/+2
* outta_swapin22002-08-062-4/+9
* general outta_swapin22002-08-062-20/+34
* fix nbrd swap out bugin22002-08-061-1/+2
* OUTTA_CACHE, nbrdin22002-08-061-4/+27
* fix idcard number bugin22002-08-061-2/+2
* fix the numbers of selection bugkcwu2002-07-281-5/+4
* fix indentkcwu2002-07-271-2/+3
* fix indent errorkcwu2002-07-271-2/+2
* 1.only sysop can edit database directlykcwu2002-07-271-5/+5
* more specific `currstat' modekcwu2002-07-273-9/+9
* show `currstat' when debug mekcwu2002-07-271-2/+2
* replace strlcat with strcat, which cause crashkcwu2002-07-271-3/+3
* error handlekcwu2002-07-271-2/+5
* fix indentkcwu2002-07-271-13/+12
* replace memcpy with memmovekcwu2002-07-271-2/+2
* typokcwu2002-07-271-2/+2
* add XXX commentkcwu2002-07-272-2/+4
* indicate which user crash mbbsdkcwu2002-07-251-2/+2
* registerin22002-07-251-3/+7
* fix lynx big5 encoding problemkcwu2002-07-231-2/+3
* remove SIZEOFin22002-07-231-12/+0
* sprintf() -> snprintf()in22002-07-2342-562/+709
* fix utmpfix bugin22002-07-231-9/+9
* fix last commit(about sprintf->snprintf)kcwu2002-07-221-23/+23
* check the using of `sizeof' with strlcpy()kcwu2002-07-228-45/+56
* fix using strlcpy() bugin22002-07-211-2/+2
* in Ptt_prints(), sprintf() -> snprintf()in22002-07-211-11/+14
* indent -i4in22002-07-2154-1954/+2045
* strcpy() -> strlcpy()in22002-07-2134-361/+382
* fix applying newboard bugin22002-07-201-3/+3
* fix **t bugin22002-07-201-2/+1
* clean up `more_web'kcwu2002-07-201-284/+5
* Xload -> Xinfoin22002-07-201-2/+2
* mail_waterballin22002-07-201-6/+9
* error returnin22002-07-201-3/+8
* remove MULTI_SERVERin22002-07-201-4/+1
* *** empty log message ***ptt2002-07-181-3/+3
* *** empty log message ***ptt2002-07-181-3/+6
* *** empty log message ***ptt2002-07-181-6/+15
* *** empty log message ***ptt2002-07-182-2/+46
* registerin22002-07-071-11/+32
* indentin22002-07-0655-14308/+15416
* sysinfoin22002-07-055-18/+27
* remove mind fixin22002-07-051-6/+1
* mindin22002-07-053-28/+27
* remove mmapin22002-07-054-25/+8
* weather url changedin22002-07-041-2/+2
* fix wrong wordin22002-07-031-2/+2
* if( !(strstr(fhdr->title, "���u") && strstr(fhdr->title, "�O�ï¿...in22002-07-031-2/+2
* do NOT reload memory if shared-memoy failsin22002-07-031-2/+3
* secure .PASSWDin22002-07-031-8/+13
* fix broadcast bugin22002-07-031-3/+6
* fix buffer overflow, search use last valuein22002-07-031-3/+6
* max search-forware 300 articlesin22002-07-021-2/+2
* title "���u�O��" formatin22002-07-021-2/+2
* use vmsg()in22002-07-021-13/+5
* fix memory bugin22002-07-024-19/+25
* hit to water programin22002-07-022-4/+21
* chdir(BBSHOME)in22002-07-011-1/+2
* avoid utmp->friendtotal errorin22002-07-011-1/+3
* fix bug (poststat)in22002-07-011-1/+1
* board cache problemin22002-07-011-6/+5
* fix �Q�j/���Q�jin22002-07-011-1/+2
* hit for registerin22002-06-301-14/+40
* not using mmap for .PASSWDin22002-06-302-57/+38
* redrawin22002-06-301-1/+3
* last oneptt2002-06-301-2/+2
* *** empty log message ***ptt2002-06-301-4/+4
* *** empty log message ***ptt2002-06-301-6/+6
* *** empty log message ***ptt2002-06-301-2/+2
* fix bugptt2002-06-301-4/+4
* *** empty log message ***ptt2002-06-301-2/+1
* *** empty log message ***ptt2002-06-301-22/+18
* testbugptt2002-06-301-17/+20
* bug of gettime:ptt2002-06-291-1/+2
* gambleptt2002-06-291-3/+7
* bid errprptt2002-06-292-5/+5
* againptt2002-06-291-2/+2
* important errorptt2002-06-291-2/+2
* add close vote once a dayptt2002-06-291-2/+5
* add close vote once a dayptt2002-06-291-2/+3
* try toplazyBMptt2002-06-292-5/+8
* setcpulimit for gambleptt2002-06-291-1/+9
* fix bug(last commit)in22002-06-281-2/+1
* two mail relay serversin22002-06-281-16/+76
* change the valid email address char set from "[].%!@:-_;" to "[].@-_"kcwu2002-06-281-3/+3
* this shouldn't existin22002-06-281-23/+0
* fix bugin22002-06-281-1/+1
* new crontabin22002-06-272-39/+146
* it seems no one need 'libutil'kcwu2002-06-271-2/+2
* build broken due to:kcwu2002-06-271-5/+5
* ignore executable 'splitpasswd'kcwu2002-06-271-0/+2
* bad filekcwu2002-06-271-9/+0
* remove nuser from SHMin22002-06-261-2/+1
* remove bbcall.optt2002-06-261-1/+1
* *** empty log message ***ptt2002-06-261-2/+2
* remove bbcall.cptt2002-06-263-9/+4
* fix deleted brdptt2002-06-261-1/+2
* I am idoitptt2002-06-261-2/+2
* fix deleted board :ptt2002-06-261-1/+7
* setproctitle("open ticket");ptt2002-06-261-1/+3
* fix bug( Admin -> SetUserPasswd )in22002-06-261-7/+10
* remove fixbfriendin22002-06-261-22/+4
* remove old board friend structure,in22002-06-262-44/+3
* remove old board friend structurein22002-06-261-7/+7
* avoid some memory error (for last commiting board friends)in22002-06-261-4/+5
* re-format, board friendin22002-06-263-121/+125
* re-format boardheader_tin22002-06-261-21/+21
* MULTI_SERVER, nusers[]in22002-06-261-1/+5
* explicitly get OSTYPE by unamekcwu2002-06-261-0/+1
* stupid bug aboutptt2002-06-231-3/+3
* little bugptt2002-06-231-3/+3
* little change about positionptt2002-06-231-3/+3
* *** empty log message ***ptt2002-06-232-3/+4
* auto expire gambleptt2002-06-232-9/+9
* auto expire gambleptt2002-06-231-2/+3
* oauto expire gambleptt2002-06-233-7/+63
* gamble lockptt2002-06-231-2/+2
* fix gamble lockptt2002-06-231-7/+13
* fix record.c stamp preformanceptt2002-06-231-2/+2
* change record stampfile functionptt2002-06-232-4/+4
* fix old letterptt2002-06-221-1/+1
* fix Link errorptt2002-06-222-5/+5
* fix gamebleptt2002-06-221-1/+2
* optt2002-06-222-4/+15
* *** empty log message ***bbs2002-06-211-2/+3
* *** empty log message ***lwms2002-06-1922-112/+147
* �� -> �Olwms2002-06-193-14/+23
* *** empty log message ***lwms2002-06-192-6/+6
* fix register bugin22002-06-171-5/+8
* *** empty log message ***ptt2002-06-173-3/+6
* *** empty log message ***ptt2002-06-171-3/+3
* fix bug (UTMPnumber)in22002-06-131-2/+2
* *** empty log message ***lwms2002-06-131-1/+1
* *** empty log message ***ptt2002-06-121-1/+6
* *** empty log message ***lwms2002-06-122-3/+3
* *** empty log message ***ptt2002-06-121-1/+2
* *** empty log message ***ptt2002-06-121-3/+5
* *** empty log message ***lwms2002-06-111-4/+4
* *** empty log message ***lwms2002-06-101-6/+5
* fix redirect bugin22002-06-091-20/+15
* fix bugin22002-06-091-2/+2
* *** empty log message ***lwms2002-06-092-4/+15
* *** empty log message ***ptt2002-06-081-2/+2
* *** empty log message ***ptt2002-06-081-3/+4
* *** empty log message ***ptt2002-06-081-2/+3
* *** empty log message ***ptt2002-06-082-17/+16
* *** empty log message ***ptt2002-06-081-2/+2
* add revoke gambleptt2002-06-081-20/+43
* *** empty log message ***ptt2002-06-081-3/+2
* *** empty log message ***ptt2002-06-081-4/+4
* add logptt2002-06-081-9/+15
* gamle and talk bug fixptt2002-06-082-6/+7
* remove uhash_tin22002-06-071-3/+1
* fix last commit bugin22002-06-071-2/+2
* fix last commit bugin22002-06-071-3/+3
* fix bugs for guest not logining when there're too few online usersin22002-06-071-25/+25
* *** empty log message ***in22002-06-071-0/+6
* fix bugin22002-06-072-6/+3
* first commitin22002-06-071-0/+32
* only one shared memoryin22002-06-0749-1070/+676
* *** empty log message ***ptt2002-06-051-4/+5
* *** empty log message ***ptt2002-06-051-2/+2
* *** empty log message ***ptt2002-06-051-1/+2
* *** empty log message ***ptt2002-06-051-10/+9