summaryrefslogtreecommitdiffstats
Commit message (Expand)AuthorAgeFilesLines
* add XXX commentkcwu2002-07-272-2/+4
* indicate which user crash mbbsdkcwu2002-07-251-2/+2
* registerin22002-07-251-3/+7
* fix lynx big5 encoding problemkcwu2002-07-231-2/+3
* remove SIZEOFin22002-07-231-12/+0
* sprintf() -> snprintf()in22002-07-2342-562/+709
* fix utmpfix bugin22002-07-231-9/+9
* fix last commit(about sprintf->snprintf)kcwu2002-07-221-23/+23
* check the using of `sizeof' with strlcpy()kcwu2002-07-228-45/+56
* fix using strlcpy() bugin22002-07-211-2/+2
* in Ptt_prints(), sprintf() -> snprintf()in22002-07-211-11/+14
* indent -i4in22002-07-2154-1954/+2045
* strcpy() -> strlcpy()in22002-07-2134-361/+382
* fix applying newboard bugin22002-07-201-3/+3
* fix **t bugin22002-07-201-2/+1
* clean up `more_web'kcwu2002-07-201-284/+5
* Xload -> Xinfoin22002-07-201-2/+2
* mail_waterballin22002-07-201-6/+9
* error returnin22002-07-201-3/+8
* remove MULTI_SERVERin22002-07-201-4/+1
* *** empty log message ***ptt2002-07-181-3/+3
* *** empty log message ***ptt2002-07-181-3/+6
* *** empty log message ***ptt2002-07-181-6/+15
* *** empty log message ***ptt2002-07-182-2/+46
* registerin22002-07-071-11/+32
* indentin22002-07-0655-14308/+15416
* sysinfoin22002-07-055-18/+27
* remove mind fixin22002-07-051-6/+1
* mindin22002-07-053-28/+27
* remove mmapin22002-07-054-25/+8
* weather url changedin22002-07-041-2/+2
* fix wrong wordin22002-07-031-2/+2
* if( !(strstr(fhdr->title, "���u") && strstr(fhdr->title, "�O�ï¿...in22002-07-031-2/+2
* do NOT reload memory if shared-memoy failsin22002-07-031-2/+3
* secure .PASSWDin22002-07-031-8/+13
* fix broadcast bugin22002-07-031-3/+6
* fix buffer overflow, search use last valuein22002-07-031-3/+6
* max search-forware 300 articlesin22002-07-021-2/+2
* title "���u�O��" formatin22002-07-021-2/+2
* use vmsg()in22002-07-021-13/+5
* fix memory bugin22002-07-024-19/+25
* hit to water programin22002-07-022-4/+21
* chdir(BBSHOME)in22002-07-011-1/+2
* avoid utmp->friendtotal errorin22002-07-011-1/+3
* fix bug (poststat)in22002-07-011-1/+1
* board cache problemin22002-07-011-6/+5
* fix �Q�j/���Q�jin22002-07-011-1/+2
* hit for registerin22002-06-301-14/+40
* not using mmap for .PASSWDin22002-06-302-57/+38
* redrawin22002-06-301-1/+3
* last oneptt2002-06-301-2/+2
* *** empty log message ***ptt2002-06-301-4/+4
* *** empty log message ***ptt2002-06-301-6/+6
* *** empty log message ***ptt2002-06-301-2/+2
* fix bugptt2002-06-301-4/+4
* *** empty log message ***ptt2002-06-301-2/+1
* *** empty log message ***ptt2002-06-301-22/+18
* testbugptt2002-06-301-17/+20
* bug of gettime:ptt2002-06-291-1/+2
* gambleptt2002-06-291-3/+7
* bid errprptt2002-06-292-5/+5
* againptt2002-06-291-2/+2
* important errorptt2002-06-291-2/+2
* add close vote once a dayptt2002-06-291-2/+5
* add close vote once a dayptt2002-06-291-2/+3
* try toplazyBMptt2002-06-292-5/+8
* setcpulimit for gambleptt2002-06-291-1/+9
* fix bug(last commit)in22002-06-281-2/+1
* two mail relay serversin22002-06-281-16/+76
* change the valid email address char set from "[].%!@:-_;" to "[].@-_"kcwu2002-06-281-3/+3
* this shouldn't existin22002-06-281-23/+0
* fix bugin22002-06-281-1/+1
* new crontabin22002-06-272-39/+146
* it seems no one need 'libutil'kcwu2002-06-271-2/+2
* build broken due to:kcwu2002-06-271-5/+5
* ignore executable 'splitpasswd'kcwu2002-06-271-0/+2
* bad filekcwu2002-06-271-9/+0
* remove nuser from SHMin22002-06-261-2/+1
* remove bbcall.optt2002-06-261-1/+1
* *** empty log message ***ptt2002-06-261-2/+2
* remove bbcall.cptt2002-06-263-9/+4
* fix deleted brdptt2002-06-261-1/+2
* I am idoitptt2002-06-261-2/+2
* fix deleted board :ptt2002-06-261-1/+7
* setproctitle("open ticket");ptt2002-06-261-1/+3
* fix bug( Admin -> SetUserPasswd )in22002-06-261-7/+10
* remove fixbfriendin22002-06-261-22/+4
* remove old board friend structure,in22002-06-262-44/+3
* remove old board friend structurein22002-06-261-7/+7
* avoid some memory error (for last commiting board friends)in22002-06-261-4/+5
* re-format, board friendin22002-06-263-121/+125
* re-format boardheader_tin22002-06-261-21/+21
* MULTI_SERVER, nusers[]in22002-06-261-1/+5
* explicitly get OSTYPE by unamekcwu2002-06-261-0/+1
* stupid bug aboutptt2002-06-231-3/+3
* little bugptt2002-06-231-3/+3
* little change about positionptt2002-06-231-3/+3
* *** empty log message ***ptt2002-06-232-3/+4
* auto expire gambleptt2002-06-232-9/+9
* auto expire gambleptt2002-06-231-2/+3
* oauto expire gambleptt2002-06-233-7/+63
* gamble lockptt2002-06-231-2/+2
* fix gamble lockptt2002-06-231-7/+13
* fix record.c stamp preformanceptt2002-06-231-2/+2
* change record stampfile functionptt2002-06-232-4/+4
* fix old letterptt2002-06-221-1/+1
* fix Link errorptt2002-06-222-5/+5
* fix gamebleptt2002-06-221-1/+2
* optt2002-06-222-4/+15
* *** empty log message ***bbs2002-06-211-2/+3
* *** empty log message ***lwms2002-06-1922-112/+147
* �� -> �Olwms2002-06-193-14/+23
* *** empty log message ***lwms2002-06-192-6/+6
* fix register bugin22002-06-171-5/+8
* *** empty log message ***ptt2002-06-173-3/+6
* *** empty log message ***ptt2002-06-171-3/+3
* fix bug (UTMPnumber)in22002-06-131-2/+2
* *** empty log message ***lwms2002-06-131-1/+1
* *** empty log message ***ptt2002-06-121-1/+6
* *** empty log message ***lwms2002-06-122-3/+3
* *** empty log message ***ptt2002-06-121-1/+2
* *** empty log message ***ptt2002-06-121-3/+5
* *** empty log message ***lwms2002-06-111-4/+4
* *** empty log message ***lwms2002-06-101-6/+5
* fix redirect bugin22002-06-091-20/+15
* fix bugin22002-06-091-2/+2
* *** empty log message ***lwms2002-06-092-4/+15
* *** empty log message ***ptt2002-06-081-2/+2
* *** empty log message ***ptt2002-06-081-3/+4
* *** empty log message ***ptt2002-06-081-2/+3
* *** empty log message ***ptt2002-06-082-17/+16
* *** empty log message ***ptt2002-06-081-2/+2
* add revoke gambleptt2002-06-081-20/+43
* *** empty log message ***ptt2002-06-081-3/+2
* *** empty log message ***ptt2002-06-081-4/+4
* add logptt2002-06-081-9/+15
* gamle and talk bug fixptt2002-06-082-6/+7
* remove uhash_tin22002-06-071-3/+1
* fix last commit bugin22002-06-071-2/+2
* fix last commit bugin22002-06-071-3/+3
* fix bugs for guest not logining when there're too few online usersin22002-06-071-25/+25
* *** empty log message ***in22002-06-071-0/+6
* fix bugin22002-06-072-6/+3
* first commitin22002-06-071-0/+32
* only one shared memoryin22002-06-0749-1070/+676
* *** empty log message ***ptt2002-06-051-4/+5
* *** empty log message ***ptt2002-06-051-2/+2
* *** empty log message ***ptt2002-06-051-1/+2
* *** empty log message ***ptt2002-06-051-10/+9
* *** empty log message ***ptt2002-06-051-2/+3
* *** empty log message ***ptt2002-06-053-26/+21
* *** empty log message ***ptt2002-06-051-20/+21
* *** empty log message ***ptt2002-06-051-3/+2
* *** empty log message ***ptt2002-06-051-4/+3
* *** empty log message ***ptt2002-06-051-4/+4
* *** empty log message ***ptt2002-06-051-2/+2
* optimize talk.cptt2002-06-051-44/+59
* fix last commit bugin22002-06-041-1/+1
* global varin22002-06-041-1/+4
* use libcryptin22002-06-042-5/+5
* global variable move to var.cin22002-06-0462-1742/+652
* only port 23 using root permissionin22002-06-031-15/+25
* permission reportin22002-06-031-8/+46
* show board friends when only friendsin22002-06-021-28/+31
* show number of board friends by countingin22002-06-021-10/+9
* board friendin22002-06-021-6/+31
* fixbfriendin22002-06-021-8/+30
* fix register bugin22002-06-021-2/+2
* register reject reasonin22002-06-021-3/+5
* *** empty log message ***lwms2002-06-021-2/+2
* iswritable_stat, isvisible_statin22002-06-025-57/+71
* 't' unsetptt2002-06-021-1/+4
* *** empty log message ***ptt2002-06-021-2/+2
* *** empty log message ***ptt2002-06-012-8/+11
* *** empty log message ***ptt2002-06-011-1/+2
* *** empty log message ***ptt2002-06-012-14/+16
* *** empty log message ***lwms2002-05-311-3/+3
* *** empty log message ***lwms2002-05-311-2/+2
* permission check when writing from article listin22002-05-312-15/+17
* everyone can't write to whom is invisiable (from article list)in22002-05-311-7/+7
* *** empty log message ***ptt2002-05-311-4/+7
* invisible fixptt2002-05-311-3/+4
* *** empty log message ***ptt2002-05-311-1/+4
* *** empty log message ***ptt2002-05-311-6/+2
* *** empty log message ***ptt2002-05-312-19/+31
* *** empty log message ***ptt2002-05-312-5/+8
* *** empty log message ***ptt2002-05-312-5/+5
* *** empty log message ***ptt2002-05-311-3/+3
* *** empty log message ***ptt2002-05-311-6/+10
* *** empty log message ***lwms2002-05-301-2/+2
* *** empty log message ***lwms2002-05-301-2/+2
* fix last commit bugin22002-05-301-4/+6
* register user if he isn't onlinein22002-05-301-2/+3
* some hintsin22002-05-301-3/+5
* recommend fix for junchoonptt2002-05-261-3/+12
* *** empty log message ***ptt2002-05-261-2/+2
* *** empty log message ***ptt2002-05-261-3/+3
* recommend fixptt2002-05-261-10/+5
* *** empty log message ***ptt2002-05-261-3/+4
* *** empty log message ***ptt2002-05-261-2/+2
* *** empty log message ***ptt2002-05-261-3/+5
* *** empty log message ***ptt2002-05-261-2/+2
* stop, STOPin22002-05-261-2/+32
* *** empty log message ***in22002-05-261-0/+3
* *** empty log message ***ptt2002-05-261-2/+2
* *** empty log message ***ptt2002-05-261-3/+12
* *** empty log message ***ptt2002-05-261-2/+2
* *** empty log message ***ptt2002-05-262-8/+15
* *** empty log message ***ptt2002-05-261-3/+4
* ofix dead lockptt2002-05-262-8/+8
* *** empty log message ***ptt2002-05-251-2/+2
* recommend fixptt2002-05-251-3/+4
* *** empty log message ***ptt2002-05-251-2/+2
* *** empty log message ***ptt2002-05-251-7/+7
* *** empty log message ***ptt2002-05-251-14/+26
* *** empty log message ***ptt2002-05-251-6/+6
* *** empty log message ***ptt2002-05-251-4/+4
* *** empty log message ***ptt2002-05-251-9/+25
* *** empty log message ***ptt2002-05-251-2/+2
* *** empty log message ***ptt2002-05-252-64/+57
* *** empty log message ***ptt2002-05-2513-58/+26
* remode savemodeptt2002-05-2511-17/+6
* *** empty log message ***ptt2002-05-252-5/+5
* fix bug - return from my_query (fast user list)in22002-05-251-1/+2
* hot board completeptt2002-05-252-4/+4
* *** empty log message ***ptt2002-05-251-2/+2
* *** empty log message ***ptt2002-05-251-2/+2
* *** empty log message ***ptt2002-05-253-9/+23
* fix bug - pickup who I reject (fast user list)in22002-05-251-8/+15
* add commonin22002-05-251-7/+7
* fix bug - dup myself in friend section (fast user list)in22002-05-251-1/+2
* fix bug(fast user list)in22002-05-251-17/+34
* *** empty log message ***ptt2002-05-251-7/+6
* *** empty log message ***ptt2002-05-251-2/+2
* *** empty log message ***ptt2002-05-252-5/+5
* *** empty log message ***ptt2002-05-252-8/+7
* *** empty log message ***ptt2002-05-252-4/+13
* *** empty log message ***ptt2002-05-253-8/+7
* brdptt2002-05-251-8/+17
* *** empty log message ***ptt2002-05-251-2/+3
* boardfriendptt2002-05-252-13/+44
* no warningin22002-05-251-2/+2
* r => read_mailin22002-05-251-1/+8
* namecomplete return the positionin22002-05-251-4/+4
* *** empty log message ***ptt2002-05-251-3/+3
* fast user listin22002-05-251-511/+568
* namecomplete return the positionin22002-05-251-9/+13
* DEBUG show pidin22002-05-251-1/+6
* dynamic allocation nbrdptt2002-05-251-8/+12
* *** empty log message ***ptt2002-05-241-2/+4